C13H11F3O8S — CID 134880353
[(2S,7R,7aS)-7a-hydroxy-6-oxo-2-phenyl-4a,7-dihydro-4H-furo[3,2-d][1,3]dioxin-7-yl] trifluoromethanesulfonate (PubChem CID 134880353) has the molecular formula C13H11F3O8S and a molecular weight of 384.28 g/mol. Its IUPAC name is [(2S,7R,7aS)-7a-hydroxy-6-oxo-2-phenyl-4a,7-dihydro-4H-furo[3,2-d][1,3]dioxin-7-yl] trifluoromethanesulfonate.
| Compound Name | [(2S,7R,7aS)-7a-hydroxy-6-oxo-2-phenyl-4a,7-dihydro-4H-furo[3,2-d][1,3]dioxin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134880353 |
| Molecular Formula | C13H11F3O8S |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | [(2S,7R,7aS)-7a-hydroxy-6-oxo-2-phenyl-4a,7-dihydro-4H-furo[3,2-d][1,3]dioxin-7-yl] trifluoromethanesulfonate |
| SMILES | O=C1OC2CO[C@H](c3ccccc3)O[C@]2(O)[C@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H11F3O8S/c14-13(15,16)25(19,20)24-9-10(17)22-8-6-21-11(23-12(8,9)18)7-4-2-1-3-5-7/h1-5,8-9,11,18H,6H2/t8?,9-,11-,12-/m0/s1 |
| InChIKey | GLGMTABEGJWWSU-BNCMJVKFSA-N |
| XLogP | 0.58 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|