C32H43NO7Si — CID 134880367
(2R)-2-[(4R,5R,6R)-6-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-oxo-3-(2-oxo-1,3-oxazolidin-3-yl)propanal (PubChem CID 134880367) has the molecular formula C32H43NO7Si and a molecular weight of 581.78 g/mol. Its IUPAC name is (2R)-2-[(4R,5R,6R)-6-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-oxo-3-(2-oxo-1,3-oxazolidin-3-yl)propanal.
| Compound Name | (2R)-2-[(4R,5R,6R)-6-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-oxo-3-(2-oxo-1,3-oxazolidin-3-yl)propanal |
|---|---|
| PubChem CID | 134880367 |
| Molecular Formula | C32H43NO7Si |
| Molecular Weight | 581.78 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | (2R)-2-[(4R,5R,6R)-6-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-oxo-3-(2-oxo-1,3-oxazolidin-3-yl)propanal |
| SMILES | C[C@H]1[C@H]([C@H](C=O)C(=O)N2CCOC2=O)OC(C)(C)O[C@@H]1[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H43NO7Si/c1-22(21-38-41(31(3,4)5,24-14-10-8-11-15-24)25-16-12-9-13-17-25)27-23(2)28(40-32(6,7)39-27)26(20-34)29(35)33-18-19-37-30(33)36/h8-17,20,22-23,26-28H,18-19,21H2,1-7H3/t22-,23-,26+,27-,28-/m1/s1 |
| InChIKey | OLAZLDKTOVGSBX-UXWAOUJDSA-N |
| XLogP | 4.15 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.78 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|