C21H25NO8 — CID 134880397
(3R,4R,5R)-5-[(1R)-1-hydroxy-2-nitro-3-phenylmethoxypropyl]-4-phenylmethoxyoxolane-2,3-diol (PubChem CID 134880397) has the molecular formula C21H25NO8 and a molecular weight of 419.43 g/mol. Its IUPAC name is (3R,4R,5R)-5-[(1R)-1-hydroxy-2-nitro-3-phenylmethoxypropyl]-4-phenylmethoxyoxolane-2,3-diol.
| Compound Name | (3R,4R,5R)-5-[(1R)-1-hydroxy-2-nitro-3-phenylmethoxypropyl]-4-phenylmethoxyoxolane-2,3-diol |
|---|---|
| PubChem CID | 134880397 |
| Molecular Formula | C21H25NO8 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (3R,4R,5R)-5-[(1R)-1-hydroxy-2-nitro-3-phenylmethoxypropyl]-4-phenylmethoxyoxolane-2,3-diol |
| SMILES | O=[N+]([O-])C(COCc1ccccc1)[C@@H](O)[C@H]1OC(O)[C@H](O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H25NO8/c23-17(16(22(26)27)13-28-11-14-7-3-1-4-8-14)20-19(18(24)21(25)30-20)29-12-15-9-5-2-6-10-15/h1-10,16-21,23-25H,11-13H2/t16?,17-,18-,19-,20-,21?/m1/s1 |
| InChIKey | WKXUJBUSPYCYRB-NQZFRGLXSA-N |
| XLogP | 0.87 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|