About 6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3,5-dimethylhexa-3,4-dien-2-ol
6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3,5-dimethylhexa-3,4-dien-2-ol (PubChem CID 134880407) has the molecular formula C16H32O4Si
and a molecular weight of 316.51 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3,5-dimethylhexa-3,4-dien-2-ol.
Molecular Properties
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3,5-dimethylhexa-3,4-dien-2-ol |
| PubChem CID | 134880407 |
| Molecular Formula | C16H32O4Si |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3,5-dimethylhexa-3,4-dien-2-ol |
| SMILES | COCOCC(O)C(C)=C=C(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O4Si/c1-13(10-20-21(7,8)16(3,4)5)9-14(2)15(17)11-19-12-18-6/h15,17H,10-12H2,1-8H3 |
| InChIKey | FSUSEOLYMSZYQP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3,5-dimethylhexa-3,4-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3,5-dimethylhexa-3,4-dien-2-ol?
The IUPAC name of 6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3,5-dimethylhexa-3,4-dien-2-ol (CID 134880407) is 6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3,5-dimethylhexa-3,4-dien-2-ol.
What is the SMILES notation for 6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3,5-dimethylhexa-3,4-dien-2-ol?
The canonical SMILES for 6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3,5-dimethylhexa-3,4-dien-2-ol is COCOCC(O)C(C)=C=C(C)CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of 6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3,5-dimethylhexa-3,4-dien-2-ol?
The InChIKey is FSUSEOLYMSZYQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O4Si/c1-13(10-20-21(7,8)16(3,4)5)9-14(2)15(17)11-19-12-18-6/h15,17H,10-12H2,1-8H3.
What are the key properties of 6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3,5-dimethylhexa-3,4-dien-2-ol?
6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3,5-dimethylhexa-3,4-dien-2-ol has a molecular weight of 316.51 g/mol, XLogP of 3.48, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3,5-dimethylhexa-3,4-dien-2-ol is sourced from PubChem (CID 134880407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).