C17H32O2Si — CID 134880408
(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethylnona-3,4,8-trien-2-ol (PubChem CID 134880408) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is (2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethylnona-3,4,8-trien-2-ol.
| Compound Name | (2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethylnona-3,4,8-trien-2-ol |
|---|---|
| PubChem CID | 134880408 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | (2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethylnona-3,4,8-trien-2-ol |
| SMILES | C=CCCC(C)=C=C(C)[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O2Si/c1-9-10-11-14(2)12-15(3)16(18)13-19-20(7,8)17(4,5)6/h9,16,18H,1,10-11,13H2,2-8H3/t12?,16-/m1/s1 |
| InChIKey | MUBIQHYHZHJLGG-PVQCJRHBSA-N |
| XLogP | 4.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|