C12H11F5O2S — CID 134880561
4,4,5,5,5-pentafluoro-1-[(R)-(4-methylphenyl)sulfinyl]pentan-2-one (PubChem CID 134880561) has the molecular formula C12H11F5O2S and a molecular weight of 314.28 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoro-1-[(R)-(4-methylphenyl)sulfinyl]pentan-2-one.
| Compound Name | 4,4,5,5,5-pentafluoro-1-[(R)-(4-methylphenyl)sulfinyl]pentan-2-one |
|---|---|
| PubChem CID | 134880561 |
| Molecular Formula | C12H11F5O2S |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 4,4,5,5,5-pentafluoro-1-[(R)-(4-methylphenyl)sulfinyl]pentan-2-one |
| SMILES | Cc1ccc([S@](=O)CC(=O)CC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H11F5O2S/c1-8-2-4-10(5-3-8)20(19)7-9(18)6-11(13,14)12(15,16)17/h2-5H,6-7H2,1H3/t20-/m1/s1 |
| InChIKey | FNIUJKMEGINCHQ-HXUWFJFHSA-N |
| XLogP | 3.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|