C25H36INO — CID 134880589
[(R)-[(2R,3S,4S)-2-benzyl-2-hydroxy-3,4-dimethylcyclohexyl]-phenylmethyl]-trimethylazanium iodide (PubChem CID 134880589) has the molecular formula C25H36INO and a molecular weight of 493.47 g/mol. Its IUPAC name is [(R)-[(2R,3S,4S)-2-benzyl-2-hydroxy-3,4-dimethylcyclohexyl]-phenylmethyl]-trimethylazanium iodide.
| Compound Name | [(R)-[(2R,3S,4S)-2-benzyl-2-hydroxy-3,4-dimethylcyclohexyl]-phenylmethyl]-trimethylazanium iodide |
|---|---|
| PubChem CID | 134880589 |
| Molecular Formula | C25H36INO |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | [(R)-[(2R,3S,4S)-2-benzyl-2-hydroxy-3,4-dimethylcyclohexyl]-phenylmethyl]-trimethylazanium iodide |
| SMILES | C[C@H]1CCC([C@H](c2ccccc2)[N+](C)(C)C)[C@@](O)(Cc2ccccc2)[C@H]1C.[I-] |
| InChI | InChI=1S/C25H36NO.HI/c1-19-16-17-23(24(26(3,4)5)22-14-10-7-11-15-22)25(27,20(19)2)18-21-12-8-6-9-13-21;/h6-15,19-20,23-24,27H,16-18H2,1-5H3;1H/q+1;/p-1/t19-,20-,23?,24-,25+;/m0./s1 |
| InChIKey | DCHLDPZKWSXDEW-KXZUAXOTSA-M |
| XLogP | 2.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|