C14H13F3O7S — CID 134880629
[(2R,4S,7R,7aR)-4-methyl-6-oxo-2-phenyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-7-yl] trifluoromethanesulfonate (PubChem CID 134880629) has the molecular formula C14H13F3O7S and a molecular weight of 382.31 g/mol. Its IUPAC name is [(2R,4S,7R,7aR)-4-methyl-6-oxo-2-phenyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-7-yl] trifluoromethanesulfonate.
| Compound Name | [(2R,4S,7R,7aR)-4-methyl-6-oxo-2-phenyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134880629 |
| Molecular Formula | C14H13F3O7S |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | [(2R,4S,7R,7aR)-4-methyl-6-oxo-2-phenyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-7-yl] trifluoromethanesulfonate |
| SMILES | C[C@@H]1O[C@@H](c2ccccc2)O[C@@H]2C1OC(=O)[C@@H]2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H13F3O7S/c1-7-9-10(23-13(21-7)8-5-3-2-4-6-8)11(12(18)22-9)24-25(19,20)14(15,16)17/h2-7,9-11,13H,1H3/t7-,9?,10+,11+,13+/m0/s1 |
| InChIKey | DGLQTBRPYIBXEN-KXCNZTJFSA-N |
| XLogP | 1.65 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|