About CID 134880709
CID 134880709 (PubChem CID 134880709) has the molecular formula C26H52O4Si3
and a molecular weight of 512.96 g/mol.
Molecular Properties
| Compound Name | CID 134880709 |
| PubChem CID | 134880709 |
| Molecular Formula | C26H52O4Si3 |
| Molecular Weight | 512.96 g/mol |
| Exact Mass | 512.32 |
| IUPAC Name | — |
| SMILES | CC[Si](CC)OC[C@H](C)[C@@H](O[Si](CC)CC)[C@@H](C)C#CC(=O)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H52O4Si3/c1-13-31(14-2)28-19-23(7)25(30-32(15-3)16-4)21(5)17-18-24(27)22(6)20-29-33(11,12)26(8,9)10/h21-23,25H,13-16,19-20H2,1-12H3/t21-,22-,23-,25-/m0/s1 |
| InChIKey | SNMNMJOSRJLDGS-LCXINAFSSA-N |
| XLogP | 6.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.96 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 134880709 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134880709?
The IUPAC name of CID 134880709 (CID 134880709) is not available.
What is the SMILES notation for CID 134880709?
The canonical SMILES for CID 134880709 is CC[Si](CC)OC[C@H](C)[C@@H](O[Si](CC)CC)[C@@H](C)C#CC(=O)[C@@H](C)CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of CID 134880709?
The InChIKey is SNMNMJOSRJLDGS-LCXINAFSSA-N. The full InChI is InChI=1S/C26H52O4Si3/c1-13-31(14-2)28-19-23(7)25(30-32(15-3)16-4)21(5)17-18-24(27)22(6)20-29-33(11,12)26(8,9)10/h21-23,25H,13-16,19-20H2,1-12H3/t21-,22-,23-,25-/m0/s1.
What are the key properties of CID 134880709?
CID 134880709 has a molecular weight of 512.96 g/mol, XLogP of 6.95, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134880709 is sourced from PubChem (CID 134880709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).