About 2-[[(3R,5S)-5-ethenyl-2-methoxyoxolan-3-yl]oxymethoxy]ethyl-trimethylsilane
2-[[(3R,5S)-5-ethenyl-2-methoxyoxolan-3-yl]oxymethoxy]ethyl-trimethylsilane (PubChem CID 134880732) has the molecular formula C13H26O4Si
and a molecular weight of 274.43 g/mol. Its IUPAC name is 2-[[(3R,5S)-5-ethenyl-2-methoxyoxolan-3-yl]oxymethoxy]ethyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-[[(3R,5S)-5-ethenyl-2-methoxyoxolan-3-yl]oxymethoxy]ethyl-trimethylsilane |
| PubChem CID | 134880732 |
| Molecular Formula | C13H26O4Si |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 2-[[(3R,5S)-5-ethenyl-2-methoxyoxolan-3-yl]oxymethoxy]ethyl-trimethylsilane |
| SMILES | C=C[C@@H]1C[C@@H](OCOCC[Si](C)(C)C)C(OC)O1 |
| InChI | InChI=1S/C13H26O4Si/c1-6-11-9-12(13(14-2)17-11)16-10-15-7-8-18(3,4)5/h6,11-13H,1,7-10H2,2-5H3/t11-,12-,13?/m1/s1 |
| InChIKey | OXBCFGZDKDRTKT-ZNRZSNADSA-N |
| XLogP | 2.63 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(3R,5S)-5-ethenyl-2-methoxyoxolan-3-yl]oxymethoxy]ethyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3R,5S)-5-ethenyl-2-methoxyoxolan-3-yl]oxymethoxy]ethyl-trimethylsilane?
The IUPAC name of 2-[[(3R,5S)-5-ethenyl-2-methoxyoxolan-3-yl]oxymethoxy]ethyl-trimethylsilane (CID 134880732) is 2-[[(3R,5S)-5-ethenyl-2-methoxyoxolan-3-yl]oxymethoxy]ethyl-trimethylsilane.
What is the SMILES notation for 2-[[(3R,5S)-5-ethenyl-2-methoxyoxolan-3-yl]oxymethoxy]ethyl-trimethylsilane?
The canonical SMILES for 2-[[(3R,5S)-5-ethenyl-2-methoxyoxolan-3-yl]oxymethoxy]ethyl-trimethylsilane is C=C[C@@H]1C[C@@H](OCOCC[Si](C)(C)C)C(OC)O1.
What is the InChIKey of 2-[[(3R,5S)-5-ethenyl-2-methoxyoxolan-3-yl]oxymethoxy]ethyl-trimethylsilane?
The InChIKey is OXBCFGZDKDRTKT-ZNRZSNADSA-N. The full InChI is InChI=1S/C13H26O4Si/c1-6-11-9-12(13(14-2)17-11)16-10-15-7-8-18(3,4)5/h6,11-13H,1,7-10H2,2-5H3/t11-,12-,13?/m1/s1.
What are the key properties of 2-[[(3R,5S)-5-ethenyl-2-methoxyoxolan-3-yl]oxymethoxy]ethyl-trimethylsilane?
2-[[(3R,5S)-5-ethenyl-2-methoxyoxolan-3-yl]oxymethoxy]ethyl-trimethylsilane has a molecular weight of 274.43 g/mol, XLogP of 2.63, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3R,5S)-5-ethenyl-2-methoxyoxolan-3-yl]oxymethoxy]ethyl-trimethylsilane is sourced from PubChem (CID 134880732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).