C18H25NO5 — CID 134880917
1-O-tert-butyl 2-O-ethyl (2R,3R)-3-(phenylmethoxymethyl)aziridine-1,2-dicarboxylate (PubChem CID 134880917) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl (2R,3R)-3-(phenylmethoxymethyl)aziridine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl (2R,3R)-3-(phenylmethoxymethyl)aziridine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134880917 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl (2R,3R)-3-(phenylmethoxymethyl)aziridine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](COCc2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25NO5/c1-5-23-16(20)15-14(19(15)17(21)24-18(2,3)4)12-22-11-13-9-7-6-8-10-13/h6-10,14-15H,5,11-12H2,1-4H3/t14-,15+,19?/m0/s1 |
| InChIKey | XNVIIDUPAFWBBZ-FPHLKLNRSA-N |
| XLogP | 2.75 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|