C9H16O2 — CID 134880986
[(2S,3R)-3-[(E)-hex-3-enyl]oxiran-2-yl]methanol (PubChem CID 134880986) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is [(2S,3R)-3-[(E)-hex-3-enyl]oxiran-2-yl]methanol.
| Compound Name | [(2S,3R)-3-[(E)-hex-3-enyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 134880986 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | [(2S,3R)-3-[(E)-hex-3-enyl]oxiran-2-yl]methanol |
| SMILES | CC/C=C/CC[C@H]1O[C@H]1CO |
| InChI | InChI=1S/C9H16O2/c1-2-3-4-5-6-8-9(7-10)11-8/h3-4,8-10H,2,5-7H2,1H3/b4-3+/t8-,9+/m1/s1 |
| InChIKey | MQDJFUJCJSWIEY-BKIAHZASSA-N |
| XLogP | 1.49 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|