About 4,5-dichloro-3-[chloro(triphenyl)-λ5-phosphanyl]oxy-6-hydroxybenzene-1,2-dicarbonitrile
4,5-dichloro-3-[chloro(triphenyl)-λ5-phosphanyl]oxy-6-hydroxybenzene-1,2-dicarbonitrile (PubChem CID 134881130) has the molecular formula C26H16Cl3N2O2P
and a molecular weight of 525.76 g/mol. Its IUPAC name is 4,5-dichloro-3-[chloro(triphenyl)-λ5-phosphanyl]oxy-6-hydroxybenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4,5-dichloro-3-[chloro(triphenyl)-λ5-phosphanyl]oxy-6-hydroxybenzene-1,2-dicarbonitrile |
| PubChem CID | 134881130 |
| Molecular Formula | C26H16Cl3N2O2P |
| Molecular Weight | 525.76 g/mol |
| Exact Mass | 524.00 |
| IUPAC Name | 4,5-dichloro-3-[chloro(triphenyl)-λ5-phosphanyl]oxy-6-hydroxybenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(O)c(Cl)c(Cl)c(OP(Cl)(c2ccccc2)(c2ccccc2)c2ccccc2)c1C#N |
| InChI | InChI=1S/C26H16Cl3N2O2P/c27-23-24(28)26(22(17-31)21(16-30)25(23)32)33-34(29,18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,32H |
| InChIKey | KRMLIELUXDNIIS-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 525.76 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dichloro-3-[chloro(triphenyl)-λ5-phosphanyl]oxy-6-hydroxybenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-3-[chloro(triphenyl)-λ5-phosphanyl]oxy-6-hydroxybenzene-1,2-dicarbonitrile?
The IUPAC name of 4,5-dichloro-3-[chloro(triphenyl)-λ5-phosphanyl]oxy-6-hydroxybenzene-1,2-dicarbonitrile (CID 134881130) is 4,5-dichloro-3-[chloro(triphenyl)-λ5-phosphanyl]oxy-6-hydroxybenzene-1,2-dicarbonitrile.
What is the SMILES notation for 4,5-dichloro-3-[chloro(triphenyl)-λ5-phosphanyl]oxy-6-hydroxybenzene-1,2-dicarbonitrile?
The canonical SMILES for 4,5-dichloro-3-[chloro(triphenyl)-λ5-phosphanyl]oxy-6-hydroxybenzene-1,2-dicarbonitrile is N#Cc1c(O)c(Cl)c(Cl)c(OP(Cl)(c2ccccc2)(c2ccccc2)c2ccccc2)c1C#N.
What is the InChIKey of 4,5-dichloro-3-[chloro(triphenyl)-λ5-phosphanyl]oxy-6-hydroxybenzene-1,2-dicarbonitrile?
The InChIKey is KRMLIELUXDNIIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H16Cl3N2O2P/c27-23-24(28)26(22(17-31)21(16-30)25(23)32)33-34(29,18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,32H.
What are the key properties of 4,5-dichloro-3-[chloro(triphenyl)-λ5-phosphanyl]oxy-6-hydroxybenzene-1,2-dicarbonitrile?
4,5-dichloro-3-[chloro(triphenyl)-λ5-phosphanyl]oxy-6-hydroxybenzene-1,2-dicarbonitrile has a molecular weight of 525.76 g/mol, XLogP of 6.42, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-3-[chloro(triphenyl)-λ5-phosphanyl]oxy-6-hydroxybenzene-1,2-dicarbonitrile is sourced from PubChem (CID 134881130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).