C39H76O6Si3 — CID 134881150
methyl 7-[(1S,2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-triethylsilyloxycyclopentyl]-7-hydroxyhept-5-ynoate (PubChem CID 134881150) has the molecular formula C39H76O6Si3 and a molecular weight of 725.29 g/mol. Its IUPAC name is methyl 7-[(1S,2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-triethylsilyloxycyclopentyl]-7-hydroxyhept-5-ynoate.
| Compound Name | methyl 7-[(1S,2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-triethylsilyloxycyclopentyl]-7-hydroxyhept-5-ynoate |
|---|---|
| PubChem CID | 134881150 |
| Molecular Formula | C39H76O6Si3 |
| Molecular Weight | 725.29 g/mol |
| Exact Mass | 724.49 |
| IUPAC Name | methyl 7-[(1S,2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-triethylsilyloxycyclopentyl]-7-hydroxyhept-5-ynoate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](C(O)C#CCCCC(=O)OC)[C@H](O[Si](CC)(CC)CC)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H76O6Si3/c1-16-20-22-25-31(43-46(12,13)38(5,6)7)28-29-32-34(44-47(14,15)39(8,9)10)30-35(45-48(17-2,18-3)19-4)37(32)33(40)26-23-21-24-27-36(41)42-11/h28-29,31-35,37,40H,16-22,24-25,27,30H2,1-15H3/b29-28+/t31-,32-,33?,34+,35+,37-/m0/s1 |
| InChIKey | ARALTHBLUWCHSF-RYVRFSIISA-N |
| XLogP | 10.64 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.29 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|