C20H36O4Si — CID 134881286
[(3aS,4S,7S,7aS)-4-prop-2-enylspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134881286) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is [(3aS,4S,7S,7aS)-4-prop-2-enylspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,4S,7S,7aS)-4-prop-2-enylspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134881286 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | [(3aS,4S,7S,7aS)-4-prop-2-enylspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CC[C@@H]1OC[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2OC3(CCCCC3)O[C@H]21 |
| InChI | InChI=1S/C20H36O4Si/c1-7-11-15-17-18(23-20(22-17)12-9-8-10-13-20)16(14-21-15)24-25(5,6)19(2,3)4/h7,15-18H,1,8-14H2,2-6H3/t15-,16-,17-,18+/m0/s1 |
| InChIKey | IMQQQVYDDMFOCW-XLAORIBOSA-N |
| XLogP | 4.80 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|