About (2S,3S)-2,3-dimethylthiane 1-oxide
(2S,3S)-2,3-dimethylthiane 1-oxide (PubChem CID 134881522) has the molecular formula C7H14OS
and a molecular weight of 146.25 g/mol. Its IUPAC name is (2S,3S)-2,3-dimethylthiane 1-oxide.
Molecular Properties
| Compound Name | (2S,3S)-2,3-dimethylthiane 1-oxide |
| PubChem CID | 134881522 |
| Molecular Formula | C7H14OS |
| Molecular Weight | 146.25 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | (2S,3S)-2,3-dimethylthiane 1-oxide |
| SMILES | C[C@H]1CCCS(=O)[C@H]1C |
| InChI | InChI=1S/C7H14OS/c1-6-4-3-5-9(8)7(6)2/h6-7H,3-5H2,1-2H3/t6-,7-,9?/m0/s1 |
| InChIKey | ARTFHKFSNBVIPU-ASLNEKEESA-N |
| XLogP | 1.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S,3S)-2,3-dimethylthiane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2,3-dimethylthiane 1-oxide?
The IUPAC name of (2S,3S)-2,3-dimethylthiane 1-oxide (CID 134881522) is (2S,3S)-2,3-dimethylthiane 1-oxide.
What is the SMILES notation for (2S,3S)-2,3-dimethylthiane 1-oxide?
The canonical SMILES for (2S,3S)-2,3-dimethylthiane 1-oxide is C[C@H]1CCCS(=O)[C@H]1C.
What is the InChIKey of (2S,3S)-2,3-dimethylthiane 1-oxide?
The InChIKey is ARTFHKFSNBVIPU-ASLNEKEESA-N. The full InChI is InChI=1S/C7H14OS/c1-6-4-3-5-9(8)7(6)2/h6-7H,3-5H2,1-2H3/t6-,7-,9?/m0/s1.
What are the key properties of (2S,3S)-2,3-dimethylthiane 1-oxide?
(2S,3S)-2,3-dimethylthiane 1-oxide has a molecular weight of 146.25 g/mol, XLogP of 1.55, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2,3-dimethylthiane 1-oxide is sourced from PubChem (CID 134881522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).