C16H21BrO2S — CID 134881610
2-(4-bromophenyl)-5-hexyl-2,3-dihydrothiophene 1,1-dioxide (PubChem CID 134881610) has the molecular formula C16H21BrO2S and a molecular weight of 357.31 g/mol. Its IUPAC name is 2-(4-bromophenyl)-5-hexyl-2,3-dihydrothiophene 1,1-dioxide.
| Compound Name | 2-(4-bromophenyl)-5-hexyl-2,3-dihydrothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 134881610 |
| Molecular Formula | C16H21BrO2S |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 2-(4-bromophenyl)-5-hexyl-2,3-dihydrothiophene 1,1-dioxide |
| SMILES | CCCCCCC1=CCC(c2ccc(Br)cc2)S1(=O)=O |
| InChI | InChI=1S/C16H21BrO2S/c1-2-3-4-5-6-15-11-12-16(20(15,18)19)13-7-9-14(17)10-8-13/h7-11,16H,2-6,12H2,1H3 |
| InChIKey | WLWZNEYZXIFBST-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|