C14H21ClO3Te — CID 134881655
methyl (Z)-3-(3-chloro-10,10-dimethyl-4-oxa-3λ4-telluratricyclo[5.2.1.01,5]decan-3-yl)prop-2-enoate (PubChem CID 134881655) has the molecular formula C14H21ClO3Te and a molecular weight of 400.37 g/mol. Its IUPAC name is methyl (Z)-3-(3-chloro-10,10-dimethyl-4-oxa-3λ4-telluratricyclo[5.2.1.01,5]decan-3-yl)prop-2-enoate.
| Compound Name | methyl (Z)-3-(3-chloro-10,10-dimethyl-4-oxa-3λ4-telluratricyclo[5.2.1.01,5]decan-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 134881655 |
| Molecular Formula | C14H21ClO3Te |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | methyl (Z)-3-(3-chloro-10,10-dimethyl-4-oxa-3λ4-telluratricyclo[5.2.1.01,5]decan-3-yl)prop-2-enoate |
| SMILES | COC(=O)/C=C\[Te]1(Cl)CC23CCC(CC2O1)C3(C)C |
| InChI | InChI=1S/C14H21ClO3Te/c1-13(2)10-4-6-14(13)9-19(15,18-11(14)8-10)7-5-12(16)17-3/h5,7,10-11H,4,6,8-9H2,1-3H3/b7-5- |
| InChIKey | WABCAPWZFFJMRV-ALCCZGGFSA-N |
| XLogP | 3.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|