About 3-benzyl-5-ethoxy-1,3,4-oxadiazol-2-one
3-benzyl-5-ethoxy-1,3,4-oxadiazol-2-one (PubChem CID 13488173) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is 3-benzyl-5-ethoxy-1,3,4-oxadiazol-2-one.
Molecular Properties
| Compound Name | 3-benzyl-5-ethoxy-1,3,4-oxadiazol-2-one |
| PubChem CID | 13488173 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 3-benzyl-5-ethoxy-1,3,4-oxadiazol-2-one |
| SMILES | CCOc1nn(Cc2ccccc2)c(=O)o1 |
| InChI | InChI=1S/C11H12N2O3/c1-2-15-10-12-13(11(14)16-10)8-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 |
| InChIKey | CZAHQLBYQIFISL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-benzyl-5-ethoxy-1,3,4-oxadiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-5-ethoxy-1,3,4-oxadiazol-2-one?
The IUPAC name of 3-benzyl-5-ethoxy-1,3,4-oxadiazol-2-one (CID 13488173) is 3-benzyl-5-ethoxy-1,3,4-oxadiazol-2-one.
What is the SMILES notation for 3-benzyl-5-ethoxy-1,3,4-oxadiazol-2-one?
The canonical SMILES for 3-benzyl-5-ethoxy-1,3,4-oxadiazol-2-one is CCOc1nn(Cc2ccccc2)c(=O)o1.
What is the InChIKey of 3-benzyl-5-ethoxy-1,3,4-oxadiazol-2-one?
The InChIKey is CZAHQLBYQIFISL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3/c1-2-15-10-12-13(11(14)16-10)8-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3.
What are the key properties of 3-benzyl-5-ethoxy-1,3,4-oxadiazol-2-one?
3-benzyl-5-ethoxy-1,3,4-oxadiazol-2-one has a molecular weight of 220.23 g/mol, XLogP of 1.28, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-5-ethoxy-1,3,4-oxadiazol-2-one is sourced from PubChem (CID 13488173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).