C20H26O6 — CID 134881802
(1R,4S,8S,9R,10S,12S,13R,15R,17R)-9,10-dihydroxy-3,14,14,17-tetramethyl-5,7-dioxapentacyclo[10.5.1.01,8.04,8.013,15]octadec-2-ene-6,18-dione (PubChem CID 134881802) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is (1R,4S,8S,9R,10S,12S,13R,15R,17R)-9,10-dihydroxy-3,14,14,17-tetramethyl-5,7-dioxapentacyclo[10.5.1.01,8.04,8.013,15]octadec-2-ene-6,18-dione.
| Compound Name | (1R,4S,8S,9R,10S,12S,13R,15R,17R)-9,10-dihydroxy-3,14,14,17-tetramethyl-5,7-dioxapentacyclo[10.5.1.01,8.04,8.013,15]octadec-2-ene-6,18-dione |
|---|---|
| PubChem CID | 134881802 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (1R,4S,8S,9R,10S,12S,13R,15R,17R)-9,10-dihydroxy-3,14,14,17-tetramethyl-5,7-dioxapentacyclo[10.5.1.01,8.04,8.013,15]octadec-2-ene-6,18-dione |
| SMILES | CC1=C[C@@]23C(=O)[C@@H](C[C@H](O)[C@@H](O)[C@@]24OC(=O)O[C@@H]14)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C20H26O6/c1-8-7-19-9(2)5-11-13(18(11,3)4)10(14(19)22)6-12(21)15(23)20(19)16(8)25-17(24)26-20/h7,9-13,15-16,21,23H,5-6H2,1-4H3/t9-,10+,11-,12+,13+,15-,16+,19-,20+/m1/s1 |
| InChIKey | ZBIYTIVHTYFSFF-FMLCZTGFSA-N |
| XLogP | 1.83 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|