C25H33NO4S — CID 134882002
(4R)-3-[1-(benzenesulfonyl)octyl]-5,5-dimethyl-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 134882002) has the molecular formula C25H33NO4S and a molecular weight of 443.61 g/mol. Its IUPAC name is (4R)-3-[1-(benzenesulfonyl)octyl]-5,5-dimethyl-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[1-(benzenesulfonyl)octyl]-5,5-dimethyl-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134882002 |
| Molecular Formula | C25H33NO4S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | (4R)-3-[1-(benzenesulfonyl)octyl]-5,5-dimethyl-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CCCCCCCC(N1C(=O)OC(C)(C)[C@H]1c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H33NO4S/c1-4-5-6-7-14-19-22(31(28,29)21-17-12-9-13-18-21)26-23(20-15-10-8-11-16-20)25(2,3)30-24(26)27/h8-13,15-18,22-23H,4-7,14,19H2,1-3H3/t22?,23-/m1/s1 |
| InChIKey | CHICTZXMHQJUCY-OZAIVSQSSA-N |
| XLogP | 6.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|