C14H21F3O2 — CID 134882157
6,6,6-trifluoro-1-[(1S,2E)-2-(methoxymethylidene)cyclohexyl]hexan-3-one (PubChem CID 134882157) has the molecular formula C14H21F3O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 6,6,6-trifluoro-1-[(1S,2E)-2-(methoxymethylidene)cyclohexyl]hexan-3-one.
| Compound Name | 6,6,6-trifluoro-1-[(1S,2E)-2-(methoxymethylidene)cyclohexyl]hexan-3-one |
|---|---|
| PubChem CID | 134882157 |
| Molecular Formula | C14H21F3O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 6,6,6-trifluoro-1-[(1S,2E)-2-(methoxymethylidene)cyclohexyl]hexan-3-one |
| SMILES | CO/C=C1\CCCC[C@H]1CCC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C14H21F3O2/c1-19-10-12-5-3-2-4-11(12)6-7-13(18)8-9-14(15,16)17/h10-11H,2-9H2,1H3/b12-10+/t11-/m0/s1 |
| InChIKey | HPVDHKANEPRNGB-OCUQMRJBSA-N |
| XLogP | 4.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|