About methyl 2-[3-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)phenyl]-2-cyanoacetate
methyl 2-[3-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)phenyl]-2-cyanoacetate (PubChem CID 134882165) has the molecular formula C20H25NO3
and a molecular weight of 327.42 g/mol. Its IUPAC name is methyl 2-[3-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)phenyl]-2-cyanoacetate.
Molecular Properties
| Compound Name | methyl 2-[3-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)phenyl]-2-cyanoacetate |
| PubChem CID | 134882165 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | methyl 2-[3-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)phenyl]-2-cyanoacetate |
| SMILES | COC(=O)C(C#N)c1cccc(C2=C(C(C)(C)C)C(C)(C)CO2)c1 |
| InChI | InChI=1S/C20H25NO3/c1-19(2,3)17-16(24-12-20(17,4)5)14-9-7-8-13(10-14)15(11-21)18(22)23-6/h7-10,15H,12H2,1-6H3 |
| InChIKey | RZDYEDWOSCAVDL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[3-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)phenyl]-2-cyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)phenyl]-2-cyanoacetate?
The IUPAC name of methyl 2-[3-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)phenyl]-2-cyanoacetate (CID 134882165) is methyl 2-[3-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)phenyl]-2-cyanoacetate.
What is the SMILES notation for methyl 2-[3-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)phenyl]-2-cyanoacetate?
The canonical SMILES for methyl 2-[3-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)phenyl]-2-cyanoacetate is COC(=O)C(C#N)c1cccc(C2=C(C(C)(C)C)C(C)(C)CO2)c1.
What is the InChIKey of methyl 2-[3-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)phenyl]-2-cyanoacetate?
The InChIKey is RZDYEDWOSCAVDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO3/c1-19(2,3)17-16(24-12-20(17,4)5)14-9-7-8-13(10-14)15(11-21)18(22)23-6/h7-10,15H,12H2,1-6H3.
What are the key properties of methyl 2-[3-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)phenyl]-2-cyanoacetate?
methyl 2-[3-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)phenyl]-2-cyanoacetate has a molecular weight of 327.42 g/mol, XLogP of 4.28, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)phenyl]-2-cyanoacetate is sourced from PubChem (CID 134882165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).