C12H13Cl3O6 — CID 134882406
[(3aR,6S,6aR)-5-[(E)-3-oxobut-1-enyl]-2-(trichloromethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate (PubChem CID 134882406) has the molecular formula C12H13Cl3O6 and a molecular weight of 359.59 g/mol. Its IUPAC name is [(3aR,6S,6aR)-5-[(E)-3-oxobut-1-enyl]-2-(trichloromethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate.
| Compound Name | [(3aR,6S,6aR)-5-[(E)-3-oxobut-1-enyl]-2-(trichloromethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate |
|---|---|
| PubChem CID | 134882406 |
| Molecular Formula | C12H13Cl3O6 |
| Molecular Weight | 359.59 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | [(3aR,6S,6aR)-5-[(E)-3-oxobut-1-enyl]-2-(trichloromethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate |
| SMILES | CC(=O)/C=C/C1O[C@@H]2OC(C(Cl)(Cl)Cl)O[C@@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C12H13Cl3O6/c1-5(16)3-4-7-8(18-6(2)17)9-10(19-7)21-11(20-9)12(13,14)15/h3-4,7-11H,1-2H3/b4-3+/t7?,8-,9+,10+,11?/m0/s1 |
| InChIKey | WDYMOMGGSCKWOR-RARJYDIMSA-N |
| XLogP | 1.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.59 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|