About 4-(1,3-dioxoisoindol-2-yl)butane-2-sulfonyl chloride
4-(1,3-dioxoisoindol-2-yl)butane-2-sulfonyl chloride (PubChem CID 134882415) has the molecular formula C12H12ClNO4S
and a molecular weight of 301.75 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)butane-2-sulfonyl chloride.
Molecular Properties
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)butane-2-sulfonyl chloride |
| PubChem CID | 134882415 |
| Molecular Formula | C12H12ClNO4S |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)butane-2-sulfonyl chloride |
| SMILES | CC(CCN1C(=O)c2ccccc2C1=O)S(=O)(=O)Cl |
| InChI | InChI=1S/C12H12ClNO4S/c1-8(19(13,17)18)6-7-14-11(15)9-4-2-3-5-10(9)12(14)16/h2-5,8H,6-7H2,1H3 |
| InChIKey | YOCMCGODWGOLOP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-dioxoisoindol-2-yl)butane-2-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dioxoisoindol-2-yl)butane-2-sulfonyl chloride?
The IUPAC name of 4-(1,3-dioxoisoindol-2-yl)butane-2-sulfonyl chloride (CID 134882415) is 4-(1,3-dioxoisoindol-2-yl)butane-2-sulfonyl chloride.
What is the SMILES notation for 4-(1,3-dioxoisoindol-2-yl)butane-2-sulfonyl chloride?
The canonical SMILES for 4-(1,3-dioxoisoindol-2-yl)butane-2-sulfonyl chloride is CC(CCN1C(=O)c2ccccc2C1=O)S(=O)(=O)Cl.
What is the InChIKey of 4-(1,3-dioxoisoindol-2-yl)butane-2-sulfonyl chloride?
The InChIKey is YOCMCGODWGOLOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClNO4S/c1-8(19(13,17)18)6-7-14-11(15)9-4-2-3-5-10(9)12(14)16/h2-5,8H,6-7H2,1H3.
What are the key properties of 4-(1,3-dioxoisoindol-2-yl)butane-2-sulfonyl chloride?
4-(1,3-dioxoisoindol-2-yl)butane-2-sulfonyl chloride has a molecular weight of 301.75 g/mol, XLogP of 1.63, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dioxoisoindol-2-yl)butane-2-sulfonyl chloride is sourced from PubChem (CID 134882415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).