C26H26NO4S2- — CID 134882418
(1Z,3R,4R)-3-methyl-4-[N-(4-methylphenyl)sulfonyl-S-phenylsulfonimidoyl]-1-phenylhexa-1,5-dien-1-olate (PubChem CID 134882418) has the molecular formula C26H26NO4S2- and a molecular weight of 480.63 g/mol. Its IUPAC name is (1Z,3R,4R)-3-methyl-4-[N-(4-methylphenyl)sulfonyl-S-phenylsulfonimidoyl]-1-phenylhexa-1,5-dien-1-olate.
| Compound Name | (1Z,3R,4R)-3-methyl-4-[N-(4-methylphenyl)sulfonyl-S-phenylsulfonimidoyl]-1-phenylhexa-1,5-dien-1-olate |
|---|---|
| PubChem CID | 134882418 |
| Molecular Formula | C26H26NO4S2- |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | (1Z,3R,4R)-3-methyl-4-[N-(4-methylphenyl)sulfonyl-S-phenylsulfonimidoyl]-1-phenylhexa-1,5-dien-1-olate |
| SMILES | C=C[C@H]([C@H](C)/C=C(\[O-])c1ccccc1)[S@@](=O)(=NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H27NO4S2/c1-4-26(21(3)19-25(28)22-11-7-5-8-12-22)32(29,23-13-9-6-10-14-23)27-33(30,31)24-17-15-20(2)16-18-24/h4-19,21,26,28H,1H2,2-3H3/p-1/b25-19-/t21-,26-,32-/m1/s1 |
| InChIKey | MCRVNFHQECCJRF-VZBVTTPLSA-M |
| XLogP | 4.80 |
| TPSA | 86.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|