C17H28O — CID 134882455
4-but-3-enoxyhepta-1,6-dien-4-ylcyclohexane (PubChem CID 134882455) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is 4-but-3-enoxyhepta-1,6-dien-4-ylcyclohexane.
| Compound Name | 4-but-3-enoxyhepta-1,6-dien-4-ylcyclohexane |
|---|---|
| PubChem CID | 134882455 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 4-but-3-enoxyhepta-1,6-dien-4-ylcyclohexane |
| SMILES | C=CCCOC(CC=C)(CC=C)C1CCCCC1 |
| InChI | InChI=1S/C17H28O/c1-4-7-15-18-17(13-5-2,14-6-3)16-11-9-8-10-12-16/h4-6,16H,1-3,7-15H2 |
| InChIKey | OUYJDEPVCZVEHR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|