C16H28O5Si — CID 134882602
[(2S,3S,4R)-3-acetyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate (PubChem CID 134882602) has the molecular formula C16H28O5Si and a molecular weight of 328.48 g/mol. Its IUPAC name is [(2S,3S,4R)-3-acetyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate.
| Compound Name | [(2S,3S,4R)-3-acetyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate |
|---|---|
| PubChem CID | 134882602 |
| Molecular Formula | C16H28O5Si |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | [(2S,3S,4R)-3-acetyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=CO[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1C(C)=O |
| InChI | InChI=1S/C16H28O5Si/c1-11(17)15-13(21-12(2)18)8-9-19-14(15)10-20-22(6,7)16(3,4)5/h8-9,13-15H,10H2,1-7H3/t13-,14-,15+/m1/s1 |
| InChIKey | RNLMCFJTODPHNA-KFWWJZLASA-N |
| XLogP | 3.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|