C18H10F12O2S — CID 134882623
1,1,1,3,3,3-hexafluoro-2-[2-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]sulfanylphenyl]propan-2-ol (PubChem CID 134882623) has the molecular formula C18H10F12O2S and a molecular weight of 518.32 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[2-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]sulfanylphenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[2-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]sulfanylphenyl]propan-2-ol |
|---|---|
| PubChem CID | 134882623 |
| Molecular Formula | C18H10F12O2S |
| Molecular Weight | 518.32 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[2-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]sulfanylphenyl]propan-2-ol |
| SMILES | OC(c1ccccc1Sc1ccccc1C(O)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H10F12O2S/c19-15(20,21)13(31,16(22,23)24)9-5-1-3-7-11(9)33-12-8-4-2-6-10(12)14(32,17(25,26)27)18(28,29)30/h1-8,31-32H |
| InChIKey | UUMWEIWTDMPVOV-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.32 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |