C41H41N2NaO7S — CID 134882838
sodium (4-methylphenyl)sulfonyl-[(E)-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ylidene]amino]azanide (PubChem CID 134882838) has the molecular formula C41H41N2NaO7S and a molecular weight of 728.84 g/mol. Its IUPAC name is sodium (4-methylphenyl)sulfonyl-[(E)-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ylidene]amino]azanide.
| Compound Name | sodium (4-methylphenyl)sulfonyl-[(E)-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ylidene]amino]azanide |
|---|---|
| PubChem CID | 134882838 |
| Molecular Formula | C41H41N2NaO7S |
| Molecular Weight | 728.84 g/mol |
| Exact Mass | 728.25 |
| IUPAC Name | sodium (4-methylphenyl)sulfonyl-[(E)-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ylidene]amino]azanide |
| SMILES | Cc1ccc(S(=O)(=O)[N-]/N=C2/O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1.[Na+] |
| InChI | InChI=1S/C41H41N2O7S.Na/c1-31-22-24-36(25-23-31)51(44,45)43-42-41-40(49-29-35-20-12-5-13-21-35)39(48-28-34-18-10-4-11-19-34)38(47-27-33-16-8-3-9-17-33)37(50-41)30-46-26-32-14-6-2-7-15-32;/h2-25,37-40H,26-30H2,1H3;/q-1;+1/b42-41+;/t37-,38-,39+,40-;/m1./s1 |
| InChIKey | OOGXEJCWPROKFW-GVHRVMQTSA-N |
| XLogP | 4.75 |
| TPSA | 106.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.84 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|