C16H24O4 — CID 134882845
[(3aS,5R,7aR)-6-methoxy-1-oxo-5-prop-1-en-2-yl-2,3,3a,4,5,6,7,7a-octahydroinden-4-yl]methyl acetate (PubChem CID 134882845) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is [(3aS,5R,7aR)-6-methoxy-1-oxo-5-prop-1-en-2-yl-2,3,3a,4,5,6,7,7a-octahydroinden-4-yl]methyl acetate.
| Compound Name | [(3aS,5R,7aR)-6-methoxy-1-oxo-5-prop-1-en-2-yl-2,3,3a,4,5,6,7,7a-octahydroinden-4-yl]methyl acetate |
|---|---|
| PubChem CID | 134882845 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | [(3aS,5R,7aR)-6-methoxy-1-oxo-5-prop-1-en-2-yl-2,3,3a,4,5,6,7,7a-octahydroinden-4-yl]methyl acetate |
| SMILES | C=C(C)[C@@H]1C(OC)C[C@H]2C(=O)CC[C@H]2C1COC(C)=O |
| InChI | InChI=1S/C16H24O4/c1-9(2)16-13(8-20-10(3)17)11-5-6-14(18)12(11)7-15(16)19-4/h11-13,15-16H,1,5-8H2,2-4H3/t11-,12-,13?,15?,16+/m1/s1 |
| InChIKey | XALNSEVBOPVUAE-PAGHFAASSA-N |
| XLogP | 2.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|