C37H42O7SSi — CID 134882903
[(2R,3S,4S,5R,6R)-2-(benzenesulfonyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]oxy-ethenyl-dimethylsilane (PubChem CID 134882903) has the molecular formula C37H42O7SSi and a molecular weight of 658.89 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-2-(benzenesulfonyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]oxy-ethenyl-dimethylsilane.
| Compound Name | [(2R,3S,4S,5R,6R)-2-(benzenesulfonyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]oxy-ethenyl-dimethylsilane |
|---|---|
| PubChem CID | 134882903 |
| Molecular Formula | C37H42O7SSi |
| Molecular Weight | 658.89 g/mol |
| Exact Mass | 658.24 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-2-(benzenesulfonyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]oxy-ethenyl-dimethylsilane |
| SMILES | C=C[Si](C)(C)O[C@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C37H42O7SSi/c1-4-46(2,3)44-36-35(42-27-31-21-13-7-14-22-31)34(41-26-30-19-11-6-12-20-30)33(28-40-25-29-17-9-5-10-18-29)43-37(36)45(38,39)32-23-15-8-16-24-32/h4-24,33-37H,1,25-28H2,2-3H3/t33-,34-,35+,36+,37-/m1/s1 |
| InChIKey | JVDAYPGJLNUGFC-GDWCTEMXSA-N |
| XLogP | 6.89 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.89 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|