C26H34O10S2 — CID 134882904
[(2R,3R,4R,5R)-2,5-dihydroxy-6-(4-methylphenyl)sulfonyloxy-3,4-bis(prop-2-enoxy)hexyl] 4-methylbenzenesulfonate (PubChem CID 134882904) has the molecular formula C26H34O10S2 and a molecular weight of 570.68 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2,5-dihydroxy-6-(4-methylphenyl)sulfonyloxy-3,4-bis(prop-2-enoxy)hexyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4R,5R)-2,5-dihydroxy-6-(4-methylphenyl)sulfonyloxy-3,4-bis(prop-2-enoxy)hexyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134882904 |
| Molecular Formula | C26H34O10S2 |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | [(2R,3R,4R,5R)-2,5-dihydroxy-6-(4-methylphenyl)sulfonyloxy-3,4-bis(prop-2-enoxy)hexyl] 4-methylbenzenesulfonate |
| SMILES | C=CCO[C@@H]([C@H](OCC=C)[C@H](O)COS(=O)(=O)c1ccc(C)cc1)[C@H](O)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H34O10S2/c1-5-15-33-25(23(27)17-35-37(29,30)21-11-7-19(3)8-12-21)26(34-16-6-2)24(28)18-36-38(31,32)22-13-9-20(4)10-14-22/h5-14,23-28H,1-2,15-18H2,3-4H3/t23-,24-,25-,26-/m1/s1 |
| InChIKey | KCUPGMLKQMFDAH-VEYUFSJPSA-N |
| XLogP | 2.28 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|