C19H30O5 — CID 134882918
(1R,4R,6R,7S,9R,11R,12S,18R)-4,7,12,18-tetramethyl-5,10,14,19-tetraoxatetracyclo[16.1.0.04,6.09,11]nonadecan-15-one (PubChem CID 134882918) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is (1R,4R,6R,7S,9R,11R,12S,18R)-4,7,12,18-tetramethyl-5,10,14,19-tetraoxatetracyclo[16.1.0.04,6.09,11]nonadecan-15-one.
| Compound Name | (1R,4R,6R,7S,9R,11R,12S,18R)-4,7,12,18-tetramethyl-5,10,14,19-tetraoxatetracyclo[16.1.0.04,6.09,11]nonadecan-15-one |
|---|---|
| PubChem CID | 134882918 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (1R,4R,6R,7S,9R,11R,12S,18R)-4,7,12,18-tetramethyl-5,10,14,19-tetraoxatetracyclo[16.1.0.04,6.09,11]nonadecan-15-one |
| SMILES | C[C@H]1COC(=O)CC[C@@]2(C)O[C@@H]2CC[C@@]2(C)O[C@@H]2[C@@H](C)C[C@H]2O[C@H]12 |
| InChI | InChI=1S/C19H30O5/c1-11-9-13-16(22-13)12(2)10-21-15(20)6-8-18(3)14(23-18)5-7-19(4)17(11)24-19/h11-14,16-17H,5-10H2,1-4H3/t11-,12-,13+,14+,16+,17+,18+,19+/m0/s1 |
| InChIKey | JLICEMWGQFJZBJ-JLFJPKFDSA-N |
| XLogP | 2.85 |
| TPSA | 63.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|