C18H23NO2 — CID 134882926
(3R,6S,7aS)-6-cyclohexyl-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 134882926) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (3R,6S,7aS)-6-cyclohexyl-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (3R,6S,7aS)-6-cyclohexyl-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 134882926 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (3R,6S,7aS)-6-cyclohexyl-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | O=C1[C@H](C2CCCCC2)C[C@H]2CO[C@H](c3ccccc3)N12 |
| InChI | InChI=1S/C18H23NO2/c20-17-16(13-7-3-1-4-8-13)11-15-12-21-18(19(15)17)14-9-5-2-6-10-14/h2,5-6,9-10,13,15-16,18H,1,3-4,7-8,11-12H2/t15-,16-,18+/m0/s1 |
| InChIKey | DUYGJDVIGYQSED-XYJFISCASA-N |
| XLogP | 3.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |