C30H54O7SSi2 — CID 134882983
[(1R,3aS,4S,5R,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-7a-methyl-4-(2-trimethylsilylethoxymethoxy)-2,3,3a,5,6,7-hexahydro-1H-inden-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 134882983) has the molecular formula C30H54O7SSi2 and a molecular weight of 614.99 g/mol. Its IUPAC name is [(1R,3aS,4S,5R,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-7a-methyl-4-(2-trimethylsilylethoxymethoxy)-2,3,3a,5,6,7-hexahydro-1H-inden-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1R,3aS,4S,5R,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-7a-methyl-4-(2-trimethylsilylethoxymethoxy)-2,3,3a,5,6,7-hexahydro-1H-inden-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134882983 |
| Molecular Formula | C30H54O7SSi2 |
| Molecular Weight | 614.99 g/mol |
| Exact Mass | 614.31 |
| IUPAC Name | [(1R,3aS,4S,5R,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-7a-methyl-4-(2-trimethylsilylethoxymethoxy)-2,3,3a,5,6,7-hexahydro-1H-inden-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@]2(OCOCC[Si](C)(C)C)[C@H](O)CC[C@@]3(C)[C@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]32)cc1 |
| InChI | InChI=1S/C30H54O7SSi2/c1-23-11-13-24(14-12-23)38(32,33)36-21-30(35-22-34-19-20-39(6,7)8)25-15-16-27(29(25,5)18-17-26(30)31)37-40(9,10)28(2,3)4/h11-14,25-27,31H,15-22H2,1-10H3/t25-,26+,27+,29+,30+/m0/s1 |
| InChIKey | NSCYIVGNXNIZPZ-YAYCRSTJSA-N |
| XLogP | 6.73 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.99 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|