C25H54O4Si2 — CID 134883019
[(2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]octyl] 2,2-dimethylpropanoate (PubChem CID 134883019) has the molecular formula C25H54O4Si2 and a molecular weight of 474.88 g/mol. Its IUPAC name is [(2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]octyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]octyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134883019 |
| Molecular Formula | C25H54O4Si2 |
| Molecular Weight | 474.88 g/mol |
| Exact Mass | 474.36 |
| IUPAC Name | [(2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]octyl] 2,2-dimethylpropanoate |
| SMILES | CCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](COC(=O)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H54O4Si2/c1-15-16-17-18-20(28-30(11,12)24(5,6)7)21(19-27-22(26)23(2,3)4)29-31(13,14)25(8,9)10/h20-21H,15-19H2,1-14H3/t20-,21-/m0/s1 |
| InChIKey | QGZHMHGECRGAPU-SFTDATJTSA-N |
| XLogP | 7.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.88 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|