C9H10O6 — CID 134883037
(1S,2S,6R,7R)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[5.3.1.02,6]undecane-8,10-dione (PubChem CID 134883037) has the molecular formula C9H10O6 and a molecular weight of 214.17 g/mol. Its IUPAC name is (1S,2S,6R,7R)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[5.3.1.02,6]undecane-8,10-dione.
| Compound Name | (1S,2S,6R,7R)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[5.3.1.02,6]undecane-8,10-dione |
|---|---|
| PubChem CID | 134883037 |
| Molecular Formula | C9H10O6 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | (1S,2S,6R,7R)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[5.3.1.02,6]undecane-8,10-dione |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H]1O[C@H]2C(=O)OC1=O |
| InChI | InChI=1S/C9H10O6/c1-9(2)14-3-4(15-9)6-8(11)13-7(10)5(3)12-6/h3-6H,1-2H3/t3-,4+,5-,6+ |
| InChIKey | LEGNAVGDLVSAJJ-FBXFSONDSA-N |
| XLogP | -0.64 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|