C30H58O7Si3 — CID 134883051
1-[[(2R,3S,4R)-3,4-bis[1-[tert-butyl(dimethyl)silyl]oxyethenoxy]-3,4-dihydro-2H-pyran-2-yl]methoxy]ethenoxy-tert-butyl-dimethylsilane (PubChem CID 134883051) has the molecular formula C30H58O7Si3 and a molecular weight of 615.05 g/mol. Its IUPAC name is 1-[[(2R,3S,4R)-3,4-bis[1-[tert-butyl(dimethyl)silyl]oxyethenoxy]-3,4-dihydro-2H-pyran-2-yl]methoxy]ethenoxy-tert-butyl-dimethylsilane.
| Compound Name | 1-[[(2R,3S,4R)-3,4-bis[1-[tert-butyl(dimethyl)silyl]oxyethenoxy]-3,4-dihydro-2H-pyran-2-yl]methoxy]ethenoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134883051 |
| Molecular Formula | C30H58O7Si3 |
| Molecular Weight | 615.05 g/mol |
| Exact Mass | 614.35 |
| IUPAC Name | 1-[[(2R,3S,4R)-3,4-bis[1-[tert-butyl(dimethyl)silyl]oxyethenoxy]-3,4-dihydro-2H-pyran-2-yl]methoxy]ethenoxy-tert-butyl-dimethylsilane |
| SMILES | C=C(OC[C@H]1OC=C[C@@H](OC(=C)O[Si](C)(C)C(C)(C)C)[C@@H]1OC(=C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H58O7Si3/c1-22(35-38(13,14)28(4,5)6)32-21-26-27(34-24(3)37-40(17,18)30(10,11)12)25(19-20-31-26)33-23(2)36-39(15,16)29(7,8)9/h19-20,25-27H,1-3,21H2,4-18H3/t25-,26-,27+/m1/s1 |
| InChIKey | SQGSEYOUGSNFRT-PFBJBMPXSA-N |
| XLogP | 9.16 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.05 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|