C14H24O4Si — CID 134883087
[(Z)-[(1S,2S,6R,7R)-4,4-dimethyl-3,5,9,12-tetraoxatricyclo[5.4.1.02,6]dodecan-11-ylidene]methyl]-trimethylsilane (PubChem CID 134883087) has the molecular formula C14H24O4Si and a molecular weight of 284.43 g/mol. Its IUPAC name is [(Z)-[(1S,2S,6R,7R)-4,4-dimethyl-3,5,9,12-tetraoxatricyclo[5.4.1.02,6]dodecan-11-ylidene]methyl]-trimethylsilane.
| Compound Name | [(Z)-[(1S,2S,6R,7R)-4,4-dimethyl-3,5,9,12-tetraoxatricyclo[5.4.1.02,6]dodecan-11-ylidene]methyl]-trimethylsilane |
|---|---|
| PubChem CID | 134883087 |
| Molecular Formula | C14H24O4Si |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | [(Z)-[(1S,2S,6R,7R)-4,4-dimethyl-3,5,9,12-tetraoxatricyclo[5.4.1.02,6]dodecan-11-ylidene]methyl]-trimethylsilane |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1COC/C(=C/[Si](C)(C)C)[C@@H]2O1 |
| InChI | InChI=1S/C14H24O4Si/c1-14(2)17-12-10-7-15-6-9(8-19(3,4)5)11(16-10)13(12)18-14/h8,10-13H,6-7H2,1-5H3/b9-8-/t10-,11+,12-,13+/m1/s1 |
| InChIKey | SDIFQBRUXBFWBQ-WBECUAAGSA-N |
| XLogP | 2.11 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|