C29H30O10S — CID 134883143
[(2S,3R,4S,5R)-3-benzoyloxy-5-(dimethoxymethyl)-4-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl benzoate (PubChem CID 134883143) has the molecular formula C29H30O10S and a molecular weight of 570.62 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-3-benzoyloxy-5-(dimethoxymethyl)-4-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,3R,4S,5R)-3-benzoyloxy-5-(dimethoxymethyl)-4-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 134883143 |
| Molecular Formula | C29H30O10S |
| Molecular Weight | 570.62 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | [(2S,3R,4S,5R)-3-benzoyloxy-5-(dimethoxymethyl)-4-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl benzoate |
| SMILES | COC(OC)[C@@H]1O[C@@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H30O10S/c1-19-14-16-22(17-15-19)40(32,33)39-25-24(38-28(31)21-12-8-5-9-13-21)23(37-26(25)29(34-2)35-3)18-36-27(30)20-10-6-4-7-11-20/h4-17,23-26,29H,18H2,1-3H3/t23-,24+,25-,26+/m0/s1 |
| InChIKey | RPAAZNBNBZAKOJ-ROXDYWFKSA-N |
| XLogP | 3.54 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.62 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|