C20H27ClN2O4S — CID 134883241
N-[(E)-[(3aR,6aS)-1-chloro-5',5'-dimethylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-ylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 134883241) has the molecular formula C20H27ClN2O4S and a molecular weight of 426.97 g/mol. Its IUPAC name is N-[(E)-[(3aR,6aS)-1-chloro-5',5'-dimethylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-ylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-[(3aR,6aS)-1-chloro-5',5'-dimethylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-ylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134883241 |
| Molecular Formula | C20H27ClN2O4S |
| Molecular Weight | 426.97 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | N-[(E)-[(3aR,6aS)-1-chloro-5',5'-dimethylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-ylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C2\C[C@@H]3CC4(C[C@@H]3C2Cl)OCC(C)(C)CO4)cc1 |
| InChI | InChI=1S/C20H27ClN2O4S/c1-13-4-6-15(7-5-13)28(24,25)23-22-17-8-14-9-20(10-16(14)18(17)21)26-11-19(2,3)12-27-20/h4-7,14,16,18,23H,8-12H2,1-3H3/b22-17+/t14-,16+,18?/m1/s1 |
| InChIKey | AKUFJMDDUIIRRQ-COOGCXSASA-N |
| XLogP | 3.44 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.97 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|