C5H8BrHgN3 — CID 134883264
[(1S,3R)-3-azido-2,2-dimethylcyclopropyl]-bromomercury (PubChem CID 134883264) has the molecular formula C5H8BrHgN3 and a molecular weight of 390.63 g/mol. Its IUPAC name is [(1S,3R)-3-azido-2,2-dimethylcyclopropyl]-bromomercury.
| Compound Name | [(1S,3R)-3-azido-2,2-dimethylcyclopropyl]-bromomercury |
|---|---|
| PubChem CID | 134883264 |
| Molecular Formula | C5H8BrHgN3 |
| Molecular Weight | 390.63 g/mol |
| Exact Mass | 390.96 |
| IUPAC Name | [(1S,3R)-3-azido-2,2-dimethylcyclopropyl]-bromomercury |
| SMILES | CC1(C)[C@H]([Hg]Br)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C5H8N3.BrH.Hg/c1-5(2)3-4(5)7-8-6;;/h3-4H,1-2H3;1H;/q;;+1/p-1/t4-;;/m0../s1 |
| InChIKey | WWYJAKJKNQVXED-FHNDMYTFSA-M |
| XLogP | 2.89 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.63 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|