About N-(2,2-dinitropropyl)-3-fluoro-3,3-dinitropropan-1-amine
N-(2,2-dinitropropyl)-3-fluoro-3,3-dinitropropan-1-amine (PubChem CID 134883319) has the molecular formula C6H10FN5O8
and a molecular weight of 299.17 g/mol. Its IUPAC name is N-(2,2-dinitropropyl)-3-fluoro-3,3-dinitropropan-1-amine.
Molecular Properties
| Compound Name | N-(2,2-dinitropropyl)-3-fluoro-3,3-dinitropropan-1-amine |
| PubChem CID | 134883319 |
| Molecular Formula | C6H10FN5O8 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | N-(2,2-dinitropropyl)-3-fluoro-3,3-dinitropropan-1-amine |
| SMILES | CC(CNCCC(F)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C6H10FN5O8/c1-5(9(13)14,10(15)16)4-8-3-2-6(7,11(17)18)12(19)20/h8H,2-4H2,1H3 |
| InChIKey | RPJWAHKJHCTNIT-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 184.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2-dinitropropyl)-3-fluoro-3,3-dinitropropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-dinitropropyl)-3-fluoro-3,3-dinitropropan-1-amine?
The IUPAC name of N-(2,2-dinitropropyl)-3-fluoro-3,3-dinitropropan-1-amine (CID 134883319) is N-(2,2-dinitropropyl)-3-fluoro-3,3-dinitropropan-1-amine.
What is the SMILES notation for N-(2,2-dinitropropyl)-3-fluoro-3,3-dinitropropan-1-amine?
The canonical SMILES for N-(2,2-dinitropropyl)-3-fluoro-3,3-dinitropropan-1-amine is CC(CNCCC(F)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of N-(2,2-dinitropropyl)-3-fluoro-3,3-dinitropropan-1-amine?
The InChIKey is RPJWAHKJHCTNIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10FN5O8/c1-5(9(13)14,10(15)16)4-8-3-2-6(7,11(17)18)12(19)20/h8H,2-4H2,1H3.
What are the key properties of N-(2,2-dinitropropyl)-3-fluoro-3,3-dinitropropan-1-amine?
N-(2,2-dinitropropyl)-3-fluoro-3,3-dinitropropan-1-amine has a molecular weight of 299.17 g/mol, XLogP of -0.59, 9 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-dinitropropyl)-3-fluoro-3,3-dinitropropan-1-amine is sourced from PubChem (CID 134883319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).