About N-(3-fluoro-3,3-dinitropropyl)-2,2-dinitrohexan-1-amine
N-(3-fluoro-3,3-dinitropropyl)-2,2-dinitrohexan-1-amine (PubChem CID 134883392) has the molecular formula C9H16FN5O8
and a molecular weight of 341.25 g/mol. Its IUPAC name is N-(3-fluoro-3,3-dinitropropyl)-2,2-dinitrohexan-1-amine.
Molecular Properties
| Compound Name | N-(3-fluoro-3,3-dinitropropyl)-2,2-dinitrohexan-1-amine |
| PubChem CID | 134883392 |
| Molecular Formula | C9H16FN5O8 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-(3-fluoro-3,3-dinitropropyl)-2,2-dinitrohexan-1-amine |
| SMILES | CCCCC(CNCCC(F)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C9H16FN5O8/c1-2-3-4-8(12(16)17,13(18)19)7-11-6-5-9(10,14(20)21)15(22)23/h11H,2-7H2,1H3 |
| InChIKey | MJSFSXUAKLZRMI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 184.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3-fluoro-3,3-dinitropropyl)-2,2-dinitrohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluoro-3,3-dinitropropyl)-2,2-dinitrohexan-1-amine?
The IUPAC name of N-(3-fluoro-3,3-dinitropropyl)-2,2-dinitrohexan-1-amine (CID 134883392) is N-(3-fluoro-3,3-dinitropropyl)-2,2-dinitrohexan-1-amine.
What is the SMILES notation for N-(3-fluoro-3,3-dinitropropyl)-2,2-dinitrohexan-1-amine?
The canonical SMILES for N-(3-fluoro-3,3-dinitropropyl)-2,2-dinitrohexan-1-amine is CCCCC(CNCCC(F)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of N-(3-fluoro-3,3-dinitropropyl)-2,2-dinitrohexan-1-amine?
The InChIKey is MJSFSXUAKLZRMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16FN5O8/c1-2-3-4-8(12(16)17,13(18)19)7-11-6-5-9(10,14(20)21)15(22)23/h11H,2-7H2,1H3.
What are the key properties of N-(3-fluoro-3,3-dinitropropyl)-2,2-dinitrohexan-1-amine?
N-(3-fluoro-3,3-dinitropropyl)-2,2-dinitrohexan-1-amine has a molecular weight of 341.25 g/mol, XLogP of 0.58, 12 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluoro-3,3-dinitropropyl)-2,2-dinitrohexan-1-amine is sourced from PubChem (CID 134883392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).