C20H11N2O2+ — CID 134883429
16,19-dioxopentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15(20),17-octaene-1-diazonium (PubChem CID 134883429) has the molecular formula C20H11N2O2+ and a molecular weight of 311.32 g/mol. Its IUPAC name is 16,19-dioxopentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15(20),17-octaene-1-diazonium.
| Compound Name | 16,19-dioxopentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15(20),17-octaene-1-diazonium |
|---|---|
| PubChem CID | 134883429 |
| Molecular Formula | C20H11N2O2+ |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 16,19-dioxopentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15(20),17-octaene-1-diazonium |
| SMILES | N#[N+]C12C3=C(C(=O)C=CC3=O)C(c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C20H11N2O2/c21-22-20-13-7-3-1-5-11(13)17(12-6-2-4-8-14(12)20)18-15(23)9-10-16(24)19(18)20/h1-10,17H/q+1 |
| InChIKey | RVSWIRLQXQLBOJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 62.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|