C29H47FN2O4 — CID 134883501
[(3S,5R,6E,8S,9S,10R,13R,14S,17R)-5-fluoro-10,13-dimethyl-17-(6-methylheptan-2-yl)-6-nitroimino-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 134883501) has the molecular formula C29H47FN2O4 and a molecular weight of 506.70 g/mol. Its IUPAC name is [(3S,5R,6E,8S,9S,10R,13R,14S,17R)-5-fluoro-10,13-dimethyl-17-(6-methylheptan-2-yl)-6-nitroimino-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5R,6E,8S,9S,10R,13R,14S,17R)-5-fluoro-10,13-dimethyl-17-(6-methylheptan-2-yl)-6-nitroimino-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 134883501 |
| Molecular Formula | C29H47FN2O4 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 506.35 |
| IUPAC Name | [(3S,5R,6E,8S,9S,10R,13R,14S,17R)-5-fluoro-10,13-dimethyl-17-(6-methylheptan-2-yl)-6-nitroimino-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)[C@H]3CC[C@]4(C)[C@@H](C(C)CCCC(C)C)CC[C@H]4[C@@H]3C/C(=N\[N+](=O)[O-])[C@@]2(F)C1 |
| InChI | InChI=1S/C29H47FN2O4/c1-18(2)8-7-9-19(3)23-10-11-24-22-16-26(31-32(34)35)29(30)17-21(36-20(4)33)12-15-28(29,6)25(22)13-14-27(23,24)5/h18-19,21-25H,7-17H2,1-6H3/b31-26+/t19?,21-,22-,23+,24-,25-,27+,28+,29-/m0/s1 |
| InChIKey | OKQHOVJPRJMWDF-ZGVWHNDCSA-N |
| XLogP | 7.37 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|