About methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-1-ium-2-yl)octanoate;chloride;iodide
methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-1-ium-2-yl)octanoate;chloride;iodide (PubChem CID 134883946) has the molecular formula C19H36ClINO2-
and a molecular weight of 472.86 g/mol. Its IUPAC name is methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-1-ium-2-yl)octanoate;chloride;iodide.
Molecular Properties
| Compound Name | methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-1-ium-2-yl)octanoate;chloride;iodide |
| PubChem CID | 134883946 |
| Molecular Formula | C19H36ClINO2- |
| Molecular Weight | 472.86 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-1-ium-2-yl)octanoate;chloride;iodide |
| SMILES | CCCCCCC1=[NH+]C(CCCCCCCC(=O)OC)CC1.[Cl-].[I-] |
| InChI | InChI=1S/C19H35NO2.ClH.HI/c1-3-4-5-9-12-17-15-16-18(20-17)13-10-7-6-8-11-14-19(21)22-2;;/h18H,3-16H2,1-2H3;2*1H/p-1 |
| InChIKey | SCBOZWMMAQACLY-UHFFFAOYSA-M |
| XLogP | -2.45 |
| TPSA | 40.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.86 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-1-ium-2-yl)octanoate;chloride;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-1-ium-2-yl)octanoate;chloride;iodide?
The IUPAC name of methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-1-ium-2-yl)octanoate;chloride;iodide (CID 134883946) is methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-1-ium-2-yl)octanoate;chloride;iodide.
What is the SMILES notation for methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-1-ium-2-yl)octanoate;chloride;iodide?
The canonical SMILES for methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-1-ium-2-yl)octanoate;chloride;iodide is CCCCCCC1=[NH+]C(CCCCCCCC(=O)OC)CC1.[Cl-].[I-].
What is the InChIKey of methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-1-ium-2-yl)octanoate;chloride;iodide?
The InChIKey is SCBOZWMMAQACLY-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H35NO2.ClH.HI/c1-3-4-5-9-12-17-15-16-18(20-17)13-10-7-6-8-11-14-19(21)22-2;;/h18H,3-16H2,1-2H3;2*1H/p-1.
What are the key properties of methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-1-ium-2-yl)octanoate;chloride;iodide?
methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-1-ium-2-yl)octanoate;chloride;iodide has a molecular weight of 472.86 g/mol, XLogP of -2.45, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-1-ium-2-yl)octanoate;chloride;iodide is sourced from PubChem (CID 134883946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).