About (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]ethanol
(1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]ethanol (PubChem CID 134884068) has the molecular formula C15H21NO3S
and a molecular weight of 295.40 g/mol. Its IUPAC name is (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]ethanol.
Molecular Properties
| Compound Name | (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]ethanol |
| PubChem CID | 134884068 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]ethanol |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H]3CCCC[C@]32[C@H](C)O)cc1 |
| InChI | InChI=1S/C15H21NO3S/c1-11-6-8-13(9-7-11)20(18,19)16-14-5-3-4-10-15(14,16)12(2)17/h6-9,12,14,17H,3-5,10H2,1-2H3/t12-,14-,15-,16?/m0/s1 |
| InChIKey | MNNDGSYQSNGAFI-UGEFFSKSSA-N |
| XLogP | 2.06 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]ethanol?
The IUPAC name of (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]ethanol (CID 134884068) is (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]ethanol.
What is the SMILES notation for (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]ethanol?
The canonical SMILES for (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]ethanol is Cc1ccc(S(=O)(=O)N2[C@H]3CCCC[C@]32[C@H](C)O)cc1.
What is the InChIKey of (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]ethanol?
The InChIKey is MNNDGSYQSNGAFI-UGEFFSKSSA-N. The full InChI is InChI=1S/C15H21NO3S/c1-11-6-8-13(9-7-11)20(18,19)16-14-5-3-4-10-15(14,16)12(2)17/h6-9,12,14,17H,3-5,10H2,1-2H3/t12-,14-,15-,16?/m0/s1.
What are the key properties of (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]ethanol?
(1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]ethanol has a molecular weight of 295.40 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]ethanol is sourced from PubChem (CID 134884068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).