About (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]propan-1-ol
(1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]propan-1-ol (PubChem CID 134884158) has the molecular formula C16H23NO3S
and a molecular weight of 309.43 g/mol. Its IUPAC name is (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]propan-1-ol.
Molecular Properties
| Compound Name | (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]propan-1-ol |
| PubChem CID | 134884158 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]propan-1-ol |
| SMILES | CC[C@H](O)[C@@]12CCCC[C@@H]1N2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H23NO3S/c1-3-15(18)16-11-5-4-6-14(16)17(16)21(19,20)13-9-7-12(2)8-10-13/h7-10,14-15,18H,3-6,11H2,1-2H3/t14-,15-,16+,17?/m0/s1 |
| InChIKey | WYSUVVWTFNQQTD-PMRDEQMMSA-N |
| XLogP | 2.45 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]propan-1-ol?
The IUPAC name of (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]propan-1-ol (CID 134884158) is (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]propan-1-ol.
What is the SMILES notation for (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]propan-1-ol?
The canonical SMILES for (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]propan-1-ol is CC[C@H](O)[C@@]12CCCC[C@@H]1N2S(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]propan-1-ol?
The InChIKey is WYSUVVWTFNQQTD-PMRDEQMMSA-N. The full InChI is InChI=1S/C16H23NO3S/c1-3-15(18)16-11-5-4-6-14(16)17(16)21(19,20)13-9-7-12(2)8-10-13/h7-10,14-15,18H,3-6,11H2,1-2H3/t14-,15-,16+,17?/m0/s1.
What are the key properties of (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]propan-1-ol?
(1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]propan-1-ol has a molecular weight of 309.43 g/mol, XLogP of 2.45, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]propan-1-ol is sourced from PubChem (CID 134884158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).